C8H11NO2S — CID 130662967
3-(1,3-thiazol-4-yl)oxan-3-ol (PubChem CID 130662967) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is 3-(1,3-thiazol-4-yl)oxan-3-ol.
| Compound Name | 3-(1,3-thiazol-4-yl)oxan-3-ol |
|---|---|
| PubChem CID | 130662967 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 3-(1,3-thiazol-4-yl)oxan-3-ol |
| SMILES | OC1(c2cscn2)CCCOC1 |
| InChI | InChI=1S/C8H11NO2S/c10-8(2-1-3-11-5-8)7-4-12-6-9-7/h4,6,10H,1-3,5H2 |
| InChIKey | AZTFIMIFJKHGTL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |