C9H16N2S — CID 130668461
N,3,5-trimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide (PubChem CID 130668461) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is N,3,5-trimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide.
| Compound Name | N,3,5-trimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
|---|---|
| PubChem CID | 130668461 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | N,3,5-trimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
| SMILES | CNC(=S)N1CC(C)=CC(C)C1 |
| InChI | InChI=1S/C9H16N2S/c1-7-4-8(2)6-11(5-7)9(12)10-3/h4,7H,5-6H2,1-3H3,(H,10,12) |
| InChIKey | GMIZRWMFTVSKTP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|