C9H17N3S — CID 130677604
1-[2-(3,6-dihydro-2H-pyridin-1-yl)ethyl]-3-methylthiourea (PubChem CID 130677604) has the molecular formula C9H17N3S and a molecular weight of 199.32 g/mol. Its IUPAC name is 1-[2-(3,6-dihydro-2H-pyridin-1-yl)ethyl]-3-methylthiourea.
| Compound Name | 1-[2-(3,6-dihydro-2H-pyridin-1-yl)ethyl]-3-methylthiourea |
|---|---|
| PubChem CID | 130677604 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 1-[2-(3,6-dihydro-2H-pyridin-1-yl)ethyl]-3-methylthiourea |
| SMILES | CNC(=S)NCCN1CC=CCC1 |
| InChI | InChI=1S/C9H17N3S/c1-10-9(13)11-5-8-12-6-3-2-4-7-12/h2-3H,4-8H2,1H3,(H2,10,11,13) |
| InChIKey | UAYIWMPPASULCM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|