C10H19N3 — CID 163952102
1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)piperazine (PubChem CID 163952102) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)piperazine.
| Compound Name | 1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)piperazine |
|---|---|
| PubChem CID | 163952102 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)piperazine |
| SMILES | CN1CC=CCC1N1CCNCC1 |
| InChI | InChI=1S/C10H19N3/c1-12-7-3-2-4-10(12)13-8-5-11-6-9-13/h2-3,10-11H,4-9H2,1H3 |
| InChIKey | SAFJQXKFCZDHEY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|