C9H18N3W- — CID 59885946
(2S,3S)-2-N,2-N,3-N,1-tetramethyl-2,3,5,6-tetrahydropyridin-5-ide-2,3-diamine;tungsten (PubChem CID 59885946) has the molecular formula C9H18N3W- and a molecular weight of 352.10 g/mol. Its IUPAC name is (2S,3S)-2-N,2-N,3-N,1-tetramethyl-2,3,5,6-tetrahydropyridin-5-ide-2,3-diamine;tungsten.
| Compound Name | (2S,3S)-2-N,2-N,3-N,1-tetramethyl-2,3,5,6-tetrahydropyridin-5-ide-2,3-diamine;tungsten |
|---|---|
| PubChem CID | 59885946 |
| Molecular Formula | C9H18N3W- |
| Molecular Weight | 352.10 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (2S,3S)-2-N,2-N,3-N,1-tetramethyl-2,3,5,6-tetrahydropyridin-5-ide-2,3-diamine;tungsten |
| SMILES | CN[C@H]1C=[C-]CN(C)[C@@H]1N(C)C.[W] |
| InChI | InChI=1S/C9H18N3.W/c1-10-8-6-5-7-12(4)9(8)11(2)3;/h6,8-10H,7H2,1-4H3;/q-1;/t8-,9-;/m0./s1 |
| InChIKey | LBDHCGACALKKAK-OZZZDHQUSA-N |
| XLogP | -0.24 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.10 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|