C9H19N3 — CID 59885947
(2S,3S)-2-N,2-N,3-N,1-tetramethyl-3,6-dihydro-2H-pyridine-2,3-diamine (PubChem CID 59885947) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is (2S,3S)-2-N,2-N,3-N,1-tetramethyl-3,6-dihydro-2H-pyridine-2,3-diamine.
| Compound Name | (2S,3S)-2-N,2-N,3-N,1-tetramethyl-3,6-dihydro-2H-pyridine-2,3-diamine |
|---|---|
| PubChem CID | 59885947 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | (2S,3S)-2-N,2-N,3-N,1-tetramethyl-3,6-dihydro-2H-pyridine-2,3-diamine |
| SMILES | CN[C@H]1C=CCN(C)[C@@H]1N(C)C |
| InChI | InChI=1S/C9H19N3/c1-10-8-6-5-7-12(4)9(8)11(2)3/h5-6,8-10H,7H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | OTHTWVOTVDFBPI-IUCAKERBSA-N |
| XLogP | -0.04 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|