C14H20Br2 — CID 13067248
(6,7-dibromo-2-methylheptan-3-yl)benzene (PubChem CID 13067248) has the molecular formula C14H20Br2 and a molecular weight of 348.12 g/mol. Its IUPAC name is (6,7-dibromo-2-methylheptan-3-yl)benzene.
| Compound Name | (6,7-dibromo-2-methylheptan-3-yl)benzene |
|---|---|
| PubChem CID | 13067248 |
| Molecular Formula | C14H20Br2 |
| Molecular Weight | 348.12 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | (6,7-dibromo-2-methylheptan-3-yl)benzene |
| SMILES | CC(C)C(CCC(Br)CBr)c1ccccc1 |
| InChI | InChI=1S/C14H20Br2/c1-11(2)14(9-8-13(16)10-15)12-6-4-3-5-7-12/h3-7,11,13-14H,8-10H2,1-2H3 |
| InChIKey | IKCRZUYEECJISS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.12 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|