C18H17NO3 — CID 13067348
5-oxo-2-phenylmethoxy-7,8-dihydro-6H-naphthalene-1-carboxamide (PubChem CID 13067348) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 5-oxo-2-phenylmethoxy-7,8-dihydro-6H-naphthalene-1-carboxamide.
| Compound Name | 5-oxo-2-phenylmethoxy-7,8-dihydro-6H-naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 13067348 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 5-oxo-2-phenylmethoxy-7,8-dihydro-6H-naphthalene-1-carboxamide |
| SMILES | NC(=O)c1c(OCc2ccccc2)ccc2c1CCCC2=O |
| InChI | InChI=1S/C18H17NO3/c19-18(21)17-14-7-4-8-15(20)13(14)9-10-16(17)22-11-12-5-2-1-3-6-12/h1-3,5-6,9-10H,4,7-8,11H2,(H2,19,21) |
| InChIKey | HBWQGFWZGBBPPV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |