C18H18O3 — CID 95561498
8-methoxy-5-phenylmethoxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 95561498) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 8-methoxy-5-phenylmethoxy-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 8-methoxy-5-phenylmethoxy-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 95561498 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 8-methoxy-5-phenylmethoxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | COc1ccc(OCc2ccccc2)c2c1C(=O)CCC2 |
| InChI | InChI=1S/C18H18O3/c1-20-17-11-10-16(14-8-5-9-15(19)18(14)17)21-12-13-6-3-2-4-7-13/h2-4,6-7,10-11H,5,8-9,12H2,1H3 |
| InChIKey | IOZQLWRBHYUYQW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |