C11H19NO — CID 130674258
3,5-dimethyl-N-prop-2-ynoxycyclohexan-1-amine (PubChem CID 130674258) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 3,5-dimethyl-N-prop-2-ynoxycyclohexan-1-amine.
| Compound Name | 3,5-dimethyl-N-prop-2-ynoxycyclohexan-1-amine |
|---|---|
| PubChem CID | 130674258 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 3,5-dimethyl-N-prop-2-ynoxycyclohexan-1-amine |
| SMILES | C#CCONC1CC(C)CC(C)C1 |
| InChI | InChI=1S/C11H19NO/c1-4-5-13-12-11-7-9(2)6-10(3)8-11/h1,9-12H,5-8H2,2-3H3 |
| InChIKey | ATYJSFSLBFBEBV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|