C8H8N2O2S — CID 130675880
(3R)-3-amino-3-(5-cyanothiophen-2-yl)propanoic acid (PubChem CID 130675880) has the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. Its IUPAC name is (3R)-3-amino-3-(5-cyanothiophen-2-yl)propanoic acid.
| Compound Name | (3R)-3-amino-3-(5-cyanothiophen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 130675880 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | (3R)-3-amino-3-(5-cyanothiophen-2-yl)propanoic acid |
| SMILES | N#Cc1ccc([C@H](N)CC(=O)O)s1 |
| InChI | InChI=1S/C8H8N2O2S/c9-4-5-1-2-7(13-5)6(10)3-8(11)12/h1-2,6H,3,10H2,(H,11,12)/t6-/m1/s1 |
| InChIKey | FNMUELXPKQVFEZ-ZCFIWIBFSA-N |
| XLogP | 1.09 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |