C8H9N3O2 — CID 130650607
(3R)-3-amino-3-(3-cyano-1H-pyrrol-2-yl)propanoic acid (PubChem CID 130650607) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is (3R)-3-amino-3-(3-cyano-1H-pyrrol-2-yl)propanoic acid.
| Compound Name | (3R)-3-amino-3-(3-cyano-1H-pyrrol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 130650607 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | (3R)-3-amino-3-(3-cyano-1H-pyrrol-2-yl)propanoic acid |
| SMILES | N#Cc1cc[nH]c1[C@H](N)CC(=O)O |
| InChI | InChI=1S/C8H9N3O2/c9-4-5-1-2-11-8(5)6(10)3-7(12)13/h1-2,6,11H,3,10H2,(H,12,13)/t6-/m1/s1 |
| InChIKey | HCPNCQPYHFYSOP-ZCFIWIBFSA-N |
| XLogP | 0.36 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |