C7H8FNO2S — CID 130682565
(3R)-3-amino-3-(5-fluorothiophen-2-yl)propanoic acid (PubChem CID 130682565) has the molecular formula C7H8FNO2S and a molecular weight of 189.21 g/mol. Its IUPAC name is (3R)-3-amino-3-(5-fluorothiophen-2-yl)propanoic acid.
| Compound Name | (3R)-3-amino-3-(5-fluorothiophen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 130682565 |
| Molecular Formula | C7H8FNO2S |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | (3R)-3-amino-3-(5-fluorothiophen-2-yl)propanoic acid |
| SMILES | N[C@H](CC(=O)O)c1ccc(F)s1 |
| InChI | InChI=1S/C7H8FNO2S/c8-6-2-1-5(12-6)4(9)3-7(10)11/h1-2,4H,3,9H2,(H,10,11)/t4-/m1/s1 |
| InChIKey | BCOFJFKQPPJJIV-SCSAIBSYSA-N |
| XLogP | 1.36 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |