C10H14N2 — CID 130682325
(1R)-6-methyl-2,3-dihydro-1H-indene-1,7-diamine (PubChem CID 130682325) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (1R)-6-methyl-2,3-dihydro-1H-indene-1,7-diamine.
| Compound Name | (1R)-6-methyl-2,3-dihydro-1H-indene-1,7-diamine |
|---|---|
| PubChem CID | 130682325 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (1R)-6-methyl-2,3-dihydro-1H-indene-1,7-diamine |
| SMILES | Cc1ccc2c(c1N)[C@H](N)CC2 |
| InChI | InChI=1S/C10H14N2/c1-6-2-3-7-4-5-8(11)9(7)10(6)12/h2-3,8H,4-5,11-12H2,1H3/t8-/m1/s1 |
| InChIKey | LATTVDHUNYWJJT-MRVPVSSYSA-N |
| XLogP | 1.52 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|