C10H12FN — CID 130739092
(1S)-5-fluoro-7-methyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 130739092) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is (1S)-5-fluoro-7-methyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S)-5-fluoro-7-methyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 130739092 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | (1S)-5-fluoro-7-methyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | Cc1cc(F)cc2c1[C@@H](N)CC2 |
| InChI | InChI=1S/C10H12FN/c1-6-4-8(11)5-7-2-3-9(12)10(6)7/h4-5,9H,2-3,12H2,1H3/t9-/m0/s1 |
| InChIKey | PMLQYFOBALBJKD-VIFPVBQESA-N |
| XLogP | 2.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |