C10H11ClN2O — CID 130682503
(3S)-3-amino-6-chloro-3,7-dimethyl-1H-indol-2-one (PubChem CID 130682503) has the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. Its IUPAC name is (3S)-3-amino-6-chloro-3,7-dimethyl-1H-indol-2-one.
| Compound Name | (3S)-3-amino-6-chloro-3,7-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 130682503 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (3S)-3-amino-6-chloro-3,7-dimethyl-1H-indol-2-one |
| SMILES | Cc1c(Cl)ccc2c1NC(=O)[C@@]2(C)N |
| InChI | InChI=1S/C10H11ClN2O/c1-5-7(11)4-3-6-8(5)13-9(14)10(6,2)12/h3-4H,12H2,1-2H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | RPBBLWGSIFUDGM-JTQLQIEISA-N |
| XLogP | 1.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |