C7H8F3N3 — CID 130689786
2-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine (PubChem CID 130689786) has the molecular formula C7H8F3N3 and a molecular weight of 191.16 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine.
| Compound Name | 2-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine |
|---|---|
| PubChem CID | 130689786 |
| Molecular Formula | C7H8F3N3 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-3-amine |
| SMILES | Nc1cccnc1[C@@H](N)C(F)(F)F |
| InChI | InChI=1S/C7H8F3N3/c8-7(9,10)6(12)5-4(11)2-1-3-13-5/h1-3,6H,11-12H2/t6-/m1/s1 |
| InChIKey | ZRQZOPXAWYCZTK-ZCFIWIBFSA-N |
| XLogP | 1.23 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |