About 1,5-dimethyl-N-(1,3-oxazol-4-ylmethyl)pyrazol-4-amine
1,5-dimethyl-N-(1,3-oxazol-4-ylmethyl)pyrazol-4-amine (PubChem CID 130690140) has the molecular formula C9H12N4O
and a molecular weight of 192.22 g/mol. Its IUPAC name is 1,5-dimethyl-N-(1,3-oxazol-4-ylmethyl)pyrazol-4-amine.
Analyze 1,5-dimethyl-N-(1,3-oxazol-4-ylmethyl)pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-N-(1,3-oxazol-4-ylmethyl)pyrazol-4-amine?
The IUPAC name of 1,5-dimethyl-N-(1,3-oxazol-4-ylmethyl)pyrazol-4-amine (CID 130690140) is 1,5-dimethyl-N-(1,3-oxazol-4-ylmethyl)pyrazol-4-amine.
What is the SMILES notation for 1,5-dimethyl-N-(1,3-oxazol-4-ylmethyl)pyrazol-4-amine?
The canonical SMILES for 1,5-dimethyl-N-(1,3-oxazol-4-ylmethyl)pyrazol-4-amine is Cc1c(NCc2cocn2)cnn1C.
What is the InChIKey of 1,5-dimethyl-N-(1,3-oxazol-4-ylmethyl)pyrazol-4-amine?
The InChIKey is WKACRJIEUDIQLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O/c1-7-9(4-12-13(7)2)10-3-8-5-14-6-11-8/h4-6,10H,3H2,1-2H3.
What are the key properties of 1,5-dimethyl-N-(1,3-oxazol-4-ylmethyl)pyrazol-4-amine?
1,5-dimethyl-N-(1,3-oxazol-4-ylmethyl)pyrazol-4-amine has a molecular weight of 192.22 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-N-(1,3-oxazol-4-ylmethyl)pyrazol-4-amine is sourced from PubChem (CID 130690140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).