C8H13NO3 — CID 130693492
N-(2-hydroxypropyl)-2,3-dihydrofuran-5-carboxamide (PubChem CID 130693492) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-2,3-dihydrofuran-5-carboxamide.
| Compound Name | N-(2-hydroxypropyl)-2,3-dihydrofuran-5-carboxamide |
|---|---|
| PubChem CID | 130693492 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | N-(2-hydroxypropyl)-2,3-dihydrofuran-5-carboxamide |
| SMILES | CC(O)CNC(=O)C1=CCCO1 |
| InChI | InChI=1S/C8H13NO3/c1-6(10)5-9-8(11)7-3-2-4-12-7/h3,6,10H,2,4-5H2,1H3,(H,9,11) |
| InChIKey | VNSUKNBFLAPBPC-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |