C10H12N2O2 — CID 130693886
[5-[(1S)-1-aminoethyl]furo[2,3-b]pyridin-2-yl]methanol (PubChem CID 130693886) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is [5-[(1S)-1-aminoethyl]furo[2,3-b]pyridin-2-yl]methanol.
| Compound Name | [5-[(1S)-1-aminoethyl]furo[2,3-b]pyridin-2-yl]methanol |
|---|---|
| PubChem CID | 130693886 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | [5-[(1S)-1-aminoethyl]furo[2,3-b]pyridin-2-yl]methanol |
| SMILES | C[C@H](N)c1cnc2oc(CO)cc2c1 |
| InChI | InChI=1S/C10H12N2O2/c1-6(11)8-2-7-3-9(5-13)14-10(7)12-4-8/h2-4,6,13H,5,11H2,1H3/t6-/m0/s1 |
| InChIKey | WPWYIYFWMMZCFP-LURJTMIESA-N |
| XLogP | 1.34 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |