About 1-(2-methyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanamine
1-(2-methyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanamine (PubChem CID 84655967) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 1-(2-methyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanamine.
Analyze 1-(2-methyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanamine?
The IUPAC name of 1-(2-methyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanamine (CID 84655967) is 1-(2-methyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanamine.
What is the SMILES notation for 1-(2-methyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanamine?
The canonical SMILES for 1-(2-methyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanamine is Cc1nc2cc(C(C)N)cnc2o1.
What is the InChIKey of 1-(2-methyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanamine?
The InChIKey is PYEBSXZYOYLUCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-5(10)7-3-8-9(11-4-7)13-6(2)12-8/h3-5H,10H2,1-2H3.
What are the key properties of 1-(2-methyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanamine?
1-(2-methyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanamine has a molecular weight of 177.21 g/mol, XLogP of 1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methyl-[1,3]oxazolo[5,4-b]pyridin-6-yl)ethanamine is sourced from PubChem (CID 84655967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).