C10H7NO3 — CID 10655251
3,10-dioxa-8-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-ylmethanol (PubChem CID 10655251) has the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. Its IUPAC name is 3,10-dioxa-8-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-ylmethanol.
| Compound Name | 3,10-dioxa-8-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-ylmethanol |
|---|---|
| PubChem CID | 10655251 |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 3,10-dioxa-8-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-ylmethanol |
| SMILES | OCc1cc2cnc3occc3c2o1 |
| InChI | InChI=1S/C10H7NO3/c12-5-7-3-6-4-11-10-8(1-2-13-10)9(6)14-7/h1-4,12H,5H2 |
| InChIKey | DIXFJIMOXJLBCW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |