C8H8ClN3OS — CID 130697553
2-(5-chlorothiophen-3-yl)-1-(2H-triazol-4-yl)ethanol (PubChem CID 130697553) has the molecular formula C8H8ClN3OS and a molecular weight of 229.69 g/mol. Its IUPAC name is 2-(5-chlorothiophen-3-yl)-1-(2H-triazol-4-yl)ethanol.
| Compound Name | 2-(5-chlorothiophen-3-yl)-1-(2H-triazol-4-yl)ethanol |
|---|---|
| PubChem CID | 130697553 |
| Molecular Formula | C8H8ClN3OS |
| Molecular Weight | 229.69 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 2-(5-chlorothiophen-3-yl)-1-(2H-triazol-4-yl)ethanol |
| SMILES | OC(Cc1csc(Cl)c1)c1cn[nH]n1 |
| InChI | InChI=1S/C8H8ClN3OS/c9-8-2-5(4-14-8)1-7(13)6-3-10-12-11-6/h2-4,7,13H,1H2,(H,10,11,12) |
| InChIKey | RHFUYCXUSUBVQM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.69 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |