C10H11Cl2N3OS — CID 107969884
(2,5-dichlorothiophen-3-yl)-(3-propyltriazol-4-yl)methanol (PubChem CID 107969884) has the molecular formula C10H11Cl2N3OS and a molecular weight of 292.19 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-(3-propyltriazol-4-yl)methanol.
| Compound Name | (2,5-dichlorothiophen-3-yl)-(3-propyltriazol-4-yl)methanol |
|---|---|
| PubChem CID | 107969884 |
| Molecular Formula | C10H11Cl2N3OS |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-(3-propyltriazol-4-yl)methanol |
| SMILES | CCCn1nncc1C(O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H11Cl2N3OS/c1-2-3-15-7(5-13-14-15)9(16)6-4-8(11)17-10(6)12/h4-5,9,16H,2-3H2,1H3 |
| InChIKey | CXDGXFOLZUJFCQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |