C8H14FN3 — CID 130703061
1-(2-fluorobutyl)-3,5-dimethyl-1,2,4-triazole (PubChem CID 130703061) has the molecular formula C8H14FN3 and a molecular weight of 171.22 g/mol. Its IUPAC name is 1-(2-fluorobutyl)-3,5-dimethyl-1,2,4-triazole.
| Compound Name | 1-(2-fluorobutyl)-3,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 130703061 |
| Molecular Formula | C8H14FN3 |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.12 |
| IUPAC Name | 1-(2-fluorobutyl)-3,5-dimethyl-1,2,4-triazole |
| SMILES | CCC(F)Cn1nc(C)nc1C |
| InChI | InChI=1S/C8H14FN3/c1-4-8(9)5-12-7(3)10-6(2)11-12/h8H,4-5H2,1-3H3 |
| InChIKey | WBPNDLOQGOUJTO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |