About N-methyl-4-(3-methyltriazol-4-yl)-1,3-thiazol-2-amine
N-methyl-4-(3-methyltriazol-4-yl)-1,3-thiazol-2-amine (PubChem CID 130703189) has the molecular formula C7H9N5S
and a molecular weight of 195.25 g/mol. Its IUPAC name is N-methyl-4-(3-methyltriazol-4-yl)-1,3-thiazol-2-amine.
Analyze N-methyl-4-(3-methyltriazol-4-yl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-(3-methyltriazol-4-yl)-1,3-thiazol-2-amine?
The IUPAC name of N-methyl-4-(3-methyltriazol-4-yl)-1,3-thiazol-2-amine (CID 130703189) is N-methyl-4-(3-methyltriazol-4-yl)-1,3-thiazol-2-amine.
What is the SMILES notation for N-methyl-4-(3-methyltriazol-4-yl)-1,3-thiazol-2-amine?
The canonical SMILES for N-methyl-4-(3-methyltriazol-4-yl)-1,3-thiazol-2-amine is CNc1nc(-c2cnnn2C)cs1.
What is the InChIKey of N-methyl-4-(3-methyltriazol-4-yl)-1,3-thiazol-2-amine?
The InChIKey is YDEYKYXWGBINEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5S/c1-8-7-10-5(4-13-7)6-3-9-11-12(6)2/h3-4H,1-2H3,(H,8,10).
What are the key properties of N-methyl-4-(3-methyltriazol-4-yl)-1,3-thiazol-2-amine?
N-methyl-4-(3-methyltriazol-4-yl)-1,3-thiazol-2-amine has a molecular weight of 195.25 g/mol, XLogP of 0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-(3-methyltriazol-4-yl)-1,3-thiazol-2-amine is sourced from PubChem (CID 130703189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).