C9H9N5S — CID 58477483
4-(3-isocyano-1-methylpyrazol-4-yl)-N-methyl-1,3-thiazol-2-amine (PubChem CID 58477483) has the molecular formula C9H9N5S and a molecular weight of 219.27 g/mol. Its IUPAC name is 4-(3-isocyano-1-methylpyrazol-4-yl)-N-methyl-1,3-thiazol-2-amine.
| Compound Name | 4-(3-isocyano-1-methylpyrazol-4-yl)-N-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58477483 |
| Molecular Formula | C9H9N5S |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 4-(3-isocyano-1-methylpyrazol-4-yl)-N-methyl-1,3-thiazol-2-amine |
| SMILES | [C-]#[N+]c1nn(C)cc1-c1csc(NC)n1 |
| InChI | InChI=1S/C9H9N5S/c1-10-8-6(4-14(3)13-8)7-5-15-9(11-2)12-7/h4-5H,2-3H3,(H,11,12) |
| InChIKey | IVZVRABMUZMOOL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 47.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|