C18H15N3S — CID 8963026
N-methyl-4-(2-phenyl-1H-indol-3-yl)-1,3-thiazol-2-amine (PubChem CID 8963026) has the molecular formula C18H15N3S and a molecular weight of 305.41 g/mol. Its IUPAC name is N-methyl-4-(2-phenyl-1H-indol-3-yl)-1,3-thiazol-2-amine.
| Compound Name | N-methyl-4-(2-phenyl-1H-indol-3-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 8963026 |
| Molecular Formula | C18H15N3S |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-methyl-4-(2-phenyl-1H-indol-3-yl)-1,3-thiazol-2-amine |
| SMILES | CNc1nc(-c2c(-c3ccccc3)[nH]c3ccccc23)cs1 |
| InChI | InChI=1S/C18H15N3S/c1-19-18-21-15(11-22-18)16-13-9-5-6-10-14(13)20-17(16)12-7-3-2-4-8-12/h2-11,20H,1H3,(H,19,21) |
| InChIKey | MQUDKBNLFQSNDK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |