C7H12ClN3S — CID 130709058
3-chloro-N-pentan-3-yl-1,2,4-thiadiazol-5-amine (PubChem CID 130709058) has the molecular formula C7H12ClN3S and a molecular weight of 205.71 g/mol. Its IUPAC name is 3-chloro-N-pentan-3-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-chloro-N-pentan-3-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 130709058 |
| Molecular Formula | C7H12ClN3S |
| Molecular Weight | 205.71 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 3-chloro-N-pentan-3-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CCC(CC)Nc1nc(Cl)ns1 |
| InChI | InChI=1S/C7H12ClN3S/c1-3-5(4-2)9-7-10-6(8)11-12-7/h5H,3-4H2,1-2H3,(H,9,10,11) |
| InChIKey | MEERYWQLEUQPER-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.71 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |