About 3-ethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one
3-ethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one (PubChem CID 130710730) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 3-ethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one.
Analyze 3-ethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
The IUPAC name of 3-ethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one (CID 130710730) is 3-ethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one.
What is the SMILES notation for 3-ethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
The canonical SMILES for 3-ethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one is CCn1cnc2c(c1=O)CCC2.
What is the InChIKey of 3-ethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
The InChIKey is UESVAFYVQDEUDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-2-11-6-10-8-5-3-4-7(8)9(11)12/h6H,2-5H2,1H3.
What are the key properties of 3-ethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
3-ethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one has a molecular weight of 164.21 g/mol, XLogP of 0.75, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one is sourced from PubChem (CID 130710730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).