C12H18N2O — CID 139239522
3-(2-methylpropyl)-5,6,7,8-tetrahydroquinazolin-4-one (PubChem CID 139239522) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-(2-methylpropyl)-5,6,7,8-tetrahydroquinazolin-4-one.
| Compound Name | 3-(2-methylpropyl)-5,6,7,8-tetrahydroquinazolin-4-one |
|---|---|
| PubChem CID | 139239522 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-(2-methylpropyl)-5,6,7,8-tetrahydroquinazolin-4-one |
| SMILES | CC(C)Cn1cnc2c(c1=O)CCCC2 |
| InChI | InChI=1S/C12H18N2O/c1-9(2)7-14-8-13-11-6-4-3-5-10(11)12(14)15/h8-9H,3-7H2,1-2H3 |
| InChIKey | HBFRTTKWRKZTBP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |