C29H48O7Si — CID 13071572
(1S,3S,18E)-16-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4,6-dihydroxy-13-methoxy-5,17,19-trimethyl-2,15-dioxatetracyclo[9.8.0.01,7.03,8]nonadeca-9,18-dien-14-one (PubChem CID 13071572) has the molecular formula C29H48O7Si and a molecular weight of 536.78 g/mol. Its IUPAC name is (1S,3S,18E)-16-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4,6-dihydroxy-13-methoxy-5,17,19-trimethyl-2,15-dioxatetracyclo[9.8.0.01,7.03,8]nonadeca-9,18-dien-14-one.
| Compound Name | (1S,3S,18E)-16-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4,6-dihydroxy-13-methoxy-5,17,19-trimethyl-2,15-dioxatetracyclo[9.8.0.01,7.03,8]nonadeca-9,18-dien-14-one |
|---|---|
| PubChem CID | 13071572 |
| Molecular Formula | C29H48O7Si |
| Molecular Weight | 536.78 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | (1S,3S,18E)-16-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4,6-dihydroxy-13-methoxy-5,17,19-trimethyl-2,15-dioxatetracyclo[9.8.0.01,7.03,8]nonadeca-9,18-dien-14-one |
| SMILES | COC1CC2C=CC3C4C(O)C(C)C(O)[C@H]3O[C@@]24/C(C)=C/C(C)C(C(C)O[Si](C)(C)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C29H48O7Si/c1-15-13-16(2)29-19(11-12-20-22(29)23(30)17(3)24(31)26(20)35-29)14-21(33-8)27(32)34-25(15)18(4)36-37(9,10)28(5,6)7/h11-13,15,17-26,30-31H,14H2,1-10H3/b16-13+/t15?,17?,18?,19?,20?,21?,22?,23?,24?,25?,26-,29-/m0/s1 |
| InChIKey | QPWHSIQKFOBXOW-DMSBGFKLSA-N |
| XLogP | 4.24 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.78 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|