C7H13NOS2 — CID 130718752
N-propan-2-yl-1,3-dithiolane-2-carboxamide (PubChem CID 130718752) has the molecular formula C7H13NOS2 and a molecular weight of 191.32 g/mol. Its IUPAC name is N-propan-2-yl-1,3-dithiolane-2-carboxamide.
| Compound Name | N-propan-2-yl-1,3-dithiolane-2-carboxamide |
|---|---|
| PubChem CID | 130718752 |
| Molecular Formula | C7H13NOS2 |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | N-propan-2-yl-1,3-dithiolane-2-carboxamide |
| SMILES | CC(C)NC(=O)C1SCCS1 |
| InChI | InChI=1S/C7H13NOS2/c1-5(2)8-6(9)7-10-3-4-11-7/h5,7H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | JAPYZJHVRAONNK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |