C8H15FN2O — CID 130720757
3-fluoro-N,4-dimethylpiperidine-1-carboxamide (PubChem CID 130720757) has the molecular formula C8H15FN2O and a molecular weight of 174.22 g/mol. Its IUPAC name is 3-fluoro-N,4-dimethylpiperidine-1-carboxamide.
| Compound Name | 3-fluoro-N,4-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 130720757 |
| Molecular Formula | C8H15FN2O |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 3-fluoro-N,4-dimethylpiperidine-1-carboxamide |
| SMILES | CNC(=O)N1CCC(C)C(F)C1 |
| InChI | InChI=1S/C8H15FN2O/c1-6-3-4-11(5-7(6)9)8(12)10-2/h6-7H,3-5H2,1-2H3,(H,10,12) |
| InChIKey | DOXFWIUIJMMAGR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |