About 2-[(1S)-1-amino-2,2-dimethylpropyl]-3-methylaniline
2-[(1S)-1-amino-2,2-dimethylpropyl]-3-methylaniline (PubChem CID 130723578) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2,2-dimethylpropyl]-3-methylaniline.
Molecular Properties
| Compound Name | 2-[(1S)-1-amino-2,2-dimethylpropyl]-3-methylaniline |
| PubChem CID | 130723578 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-[(1S)-1-amino-2,2-dimethylpropyl]-3-methylaniline |
| SMILES | Cc1cccc(N)c1[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C12H20N2/c1-8-6-5-7-9(13)10(8)11(14)12(2,3)4/h5-7,11H,13-14H2,1-4H3/t11-/m1/s1 |
| InChIKey | CAVGAFHQOXURCC-LLVKDONJSA-N |
| XLogP | 2.62 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S)-1-amino-2,2-dimethylpropyl]-3-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S)-1-amino-2,2-dimethylpropyl]-3-methylaniline?
The IUPAC name of 2-[(1S)-1-amino-2,2-dimethylpropyl]-3-methylaniline (CID 130723578) is 2-[(1S)-1-amino-2,2-dimethylpropyl]-3-methylaniline.
What is the SMILES notation for 2-[(1S)-1-amino-2,2-dimethylpropyl]-3-methylaniline?
The canonical SMILES for 2-[(1S)-1-amino-2,2-dimethylpropyl]-3-methylaniline is Cc1cccc(N)c1[C@@H](N)C(C)(C)C.
What is the InChIKey of 2-[(1S)-1-amino-2,2-dimethylpropyl]-3-methylaniline?
The InChIKey is CAVGAFHQOXURCC-LLVKDONJSA-N. The full InChI is InChI=1S/C12H20N2/c1-8-6-5-7-9(13)10(8)11(14)12(2,3)4/h5-7,11H,13-14H2,1-4H3/t11-/m1/s1.
What are the key properties of 2-[(1S)-1-amino-2,2-dimethylpropyl]-3-methylaniline?
2-[(1S)-1-amino-2,2-dimethylpropyl]-3-methylaniline has a molecular weight of 192.31 g/mol, XLogP of 2.62, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S)-1-amino-2,2-dimethylpropyl]-3-methylaniline is sourced from PubChem (CID 130723578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).