C9H19NS2 — CID 130731467
(1S)-1-(1,3-dithian-2-yl)-3-methylbutan-1-amine (PubChem CID 130731467) has the molecular formula C9H19NS2 and a molecular weight of 205.39 g/mol. Its IUPAC name is (1S)-1-(1,3-dithian-2-yl)-3-methylbutan-1-amine.
| Compound Name | (1S)-1-(1,3-dithian-2-yl)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 130731467 |
| Molecular Formula | C9H19NS2 |
| Molecular Weight | 205.39 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (1S)-1-(1,3-dithian-2-yl)-3-methylbutan-1-amine |
| SMILES | CC(C)C[C@H](N)C1SCCCS1 |
| InChI | InChI=1S/C9H19NS2/c1-7(2)6-8(10)9-11-4-3-5-12-9/h7-9H,3-6,10H2,1-2H3/t8-/m0/s1 |
| InChIKey | XMIKHGAHPHVOFF-QMMMGPOBSA-N |
| XLogP | 2.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |