C11H19IS2 — CID 11131666
2-[(E,2R,4S)-6-iodo-4-methylhex-5-en-2-yl]-1,3-dithiane (PubChem CID 11131666) has the molecular formula C11H19IS2 and a molecular weight of 342.31 g/mol. Its IUPAC name is 2-[(E,2R,4S)-6-iodo-4-methylhex-5-en-2-yl]-1,3-dithiane.
| Compound Name | 2-[(E,2R,4S)-6-iodo-4-methylhex-5-en-2-yl]-1,3-dithiane |
|---|---|
| PubChem CID | 11131666 |
| Molecular Formula | C11H19IS2 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 2-[(E,2R,4S)-6-iodo-4-methylhex-5-en-2-yl]-1,3-dithiane |
| SMILES | C[C@H](/C=C/I)C[C@@H](C)C1SCCCS1 |
| InChI | InChI=1S/C11H19IS2/c1-9(4-5-12)8-10(2)11-13-6-3-7-14-11/h4-5,9-11H,3,6-8H2,1-2H3/b5-4+/t9-,10-/m1/s1 |
| InChIKey | XGFBIRJJYUZFKK-NUNSBDKSSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|