C21H36O3Si — CID 13073171
tert-butyl-dimethyl-[(1R,2R,3S,5S,6E,10R)-8-methylidene-5-propan-2-ylspiro[11-oxabicyclo[8.1.0]undec-6-ene-2,2'-oxirane]-3-yl]oxysilane (PubChem CID 13073171) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,2R,3S,5S,6E,10R)-8-methylidene-5-propan-2-ylspiro[11-oxabicyclo[8.1.0]undec-6-ene-2,2'-oxirane]-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R,2R,3S,5S,6E,10R)-8-methylidene-5-propan-2-ylspiro[11-oxabicyclo[8.1.0]undec-6-ene-2,2'-oxirane]-3-yl]oxysilane |
|---|---|
| PubChem CID | 13073171 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,2R,3S,5S,6E,10R)-8-methylidene-5-propan-2-ylspiro[11-oxabicyclo[8.1.0]undec-6-ene-2,2'-oxirane]-3-yl]oxysilane |
| SMILES | C=C1/C=C/[C@H](C(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(CO2)[C@@H]2O[C@@H]2C1 |
| InChI | InChI=1S/C21H36O3Si/c1-14(2)16-10-9-15(3)11-17-19(23-17)21(13-22-21)18(12-16)24-25(7,8)20(4,5)6/h9-10,14,16-19H,3,11-13H2,1-2,4-8H3/b10-9+/t16-,17+,18-,19+,21-/m0/s1 |
| InChIKey | PKSJOUMJKZHIRA-TYAOIIAZSA-N |
| XLogP | 5.09 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|