C24H46O3Si — CID 134942486
[(2S,3S)-3-methyl-3-[2-[(2R,3R)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]ethyl]oxiran-2-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 134942486) has the molecular formula C24H46O3Si and a molecular weight of 410.72 g/mol. Its IUPAC name is [(2S,3S)-3-methyl-3-[2-[(2R,3R)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]ethyl]oxiran-2-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(2S,3S)-3-methyl-3-[2-[(2R,3R)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]ethyl]oxiran-2-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134942486 |
| Molecular Formula | C24H46O3Si |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | [(2S,3S)-3-methyl-3-[2-[(2R,3R)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]ethyl]oxiran-2-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)=CCC[C@@]1(C)O[C@@H]1CC[C@]1(C)O[C@H]1CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H46O3Si/c1-17(2)12-11-14-23(9)21(26-23)13-15-24(10)22(27-24)16-25-28(18(3)4,19(5)6)20(7)8/h12,18-22H,11,13-16H2,1-10H3/t21-,22+,23-,24+/m1/s1 |
| InChIKey | HMJDUULHQPLKIV-QPXUXIHVSA-N |
| XLogP | 7.02 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|