C22H38O2Si — CID 134882890
[(E)-9-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-7-methylnon-6-en-2-ynyl]-trimethylsilane (PubChem CID 134882890) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is [(E)-9-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-7-methylnon-6-en-2-ynyl]-trimethylsilane.
| Compound Name | [(E)-9-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-7-methylnon-6-en-2-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 134882890 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | [(E)-9-[(2R,3R)-3-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethyl]-3-methyloxiran-2-yl]-7-methylnon-6-en-2-ynyl]-trimethylsilane |
| SMILES | C/C(=C\CCC#CC[Si](C)(C)C)CC[C@H]1O[C@]1(C)CC[C@H]1OC1(C)C |
| InChI | InChI=1S/C22H38O2Si/c1-18(12-10-8-9-11-17-25(5,6)7)13-14-20-22(4,24-20)16-15-19-21(2,3)23-19/h12,19-20H,8,10,13-17H2,1-7H3/b18-12+/t19-,20-,22-/m1/s1 |
| InChIKey | IQTDVSPJFMPYTB-RMFCFHNFSA-N |
| XLogP | 5.95 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|