C17H34O2Si — CID 135041015
trimethyl-[2-methyl-4-[(2S,3R)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]butan-2-yl]oxysilane (PubChem CID 135041015) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is trimethyl-[2-methyl-4-[(2S,3R)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]butan-2-yl]oxysilane.
| Compound Name | trimethyl-[2-methyl-4-[(2S,3R)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]butan-2-yl]oxysilane |
|---|---|
| PubChem CID | 135041015 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | trimethyl-[2-methyl-4-[(2S,3R)-3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]butan-2-yl]oxysilane |
| SMILES | CC(C)=CCC[C@@]1(C)O[C@H]1CCC(C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H34O2Si/c1-14(2)10-9-12-17(5)15(18-17)11-13-16(3,4)19-20(6,7)8/h10,15H,9,11-13H2,1-8H3/t15-,17+/m0/s1 |
| InChIKey | HOTXUXFBWSHVDR-DOTOQJQBSA-N |
| XLogP | 5.30 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|