C26H46O2Si — CID 177406255
tert-butyl-dimethyl-[[(1S,2S,6E,10E,14S)-6,10,14-trimethyl-3-prop-1-en-2-yl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-2-yl]oxy]silane (PubChem CID 177406255) has the molecular formula C26H46O2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,2S,6E,10E,14S)-6,10,14-trimethyl-3-prop-1-en-2-yl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-2-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,2S,6E,10E,14S)-6,10,14-trimethyl-3-prop-1-en-2-yl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-2-yl]oxy]silane |
|---|---|
| PubChem CID | 177406255 |
| Molecular Formula | C26H46O2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,2S,6E,10E,14S)-6,10,14-trimethyl-3-prop-1-en-2-yl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-2-yl]oxy]silane |
| SMILES | C=C(C)C1CC/C(C)=C/CC/C(C)=C/CC[C@]2(C)O[C@H]2[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O2Si/c1-19(2)22-17-16-21(4)14-11-13-20(3)15-12-18-26(8)24(27-26)23(22)28-29(9,10)25(5,6)7/h14-15,22-24H,1,11-13,16-18H2,2-10H3/b20-15+,21-14+/t22?,23-,24-,26-/m0/s1 |
| InChIKey | FUNDGTHDAOIUKT-UILJGDAYSA-N |
| XLogP | 7.97 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|