C9H10N2OS — CID 130735490
5-methyl-N-(thiophen-2-ylmethyl)-1,3-oxazol-2-amine (PubChem CID 130735490) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is 5-methyl-N-(thiophen-2-ylmethyl)-1,3-oxazol-2-amine.
| Compound Name | 5-methyl-N-(thiophen-2-ylmethyl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 130735490 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 5-methyl-N-(thiophen-2-ylmethyl)-1,3-oxazol-2-amine |
| SMILES | Cc1cnc(NCc2cccs2)o1 |
| InChI | InChI=1S/C9H10N2OS/c1-7-5-10-9(12-7)11-6-8-3-2-4-13-8/h2-5H,6H2,1H3,(H,10,11) |
| InChIKey | SSFWCUJBTXTKOS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |