C15H23N5O — CID 13073795
4-[4-(ethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]piperazine-1-carbaldehyde (PubChem CID 13073795) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-[4-(ethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[4-(ethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 13073795 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 4-[4-(ethylamino)-5,6,7,8-tetrahydroquinazolin-2-yl]piperazine-1-carbaldehyde |
| SMILES | CCNc1nc(N2CCN(C=O)CC2)nc2c1CCCC2 |
| InChI | InChI=1S/C15H23N5O/c1-2-16-14-12-5-3-4-6-13(12)17-15(18-14)20-9-7-19(11-21)8-10-20/h11H,2-10H2,1H3,(H,16,17,18) |
| InChIKey | GOKFRZAHSSHUNV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|