About 4-(4-phenoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)piperazine-1-carbaldehyde
4-(4-phenoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)piperazine-1-carbaldehyde (PubChem CID 88772086) has the molecular formula C18H20N4O2
and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-(4-phenoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)piperazine-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-(4-phenoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)piperazine-1-carbaldehyde |
| PubChem CID | 88772086 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-(4-phenoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(c2nc3c(c(Oc4ccccc4)n2)CCC3)CC1 |
| InChI | InChI=1S/C18H20N4O2/c23-13-21-9-11-22(12-10-21)18-19-16-8-4-7-15(16)17(20-18)24-14-5-2-1-3-6-14/h1-3,5-6,13H,4,7-12H2 |
| InChIKey | HKFZFAOYBNGHLG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-phenoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)piperazine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-phenoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)piperazine-1-carbaldehyde?
The IUPAC name of 4-(4-phenoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)piperazine-1-carbaldehyde (CID 88772086) is 4-(4-phenoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)piperazine-1-carbaldehyde.
What is the SMILES notation for 4-(4-phenoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)piperazine-1-carbaldehyde?
The canonical SMILES for 4-(4-phenoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)piperazine-1-carbaldehyde is O=CN1CCN(c2nc3c(c(Oc4ccccc4)n2)CCC3)CC1.
What is the InChIKey of 4-(4-phenoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)piperazine-1-carbaldehyde?
The InChIKey is HKFZFAOYBNGHLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O2/c23-13-21-9-11-22(12-10-21)18-19-16-8-4-7-15(16)17(20-18)24-14-5-2-1-3-6-14/h1-3,5-6,13H,4,7-12H2.
What are the key properties of 4-(4-phenoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)piperazine-1-carbaldehyde?
4-(4-phenoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)piperazine-1-carbaldehyde has a molecular weight of 324.38 g/mol, XLogP of 2.04, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-phenoxy-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)piperazine-1-carbaldehyde is sourced from PubChem (CID 88772086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).