C15H21N5OS — CID 88740274
4-[6-ethyl-5-methyl-4-(methylamino)thieno[2,3-d]pyrimidin-2-yl]piperazine-1-carbaldehyde (PubChem CID 88740274) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is 4-[6-ethyl-5-methyl-4-(methylamino)thieno[2,3-d]pyrimidin-2-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[6-ethyl-5-methyl-4-(methylamino)thieno[2,3-d]pyrimidin-2-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 88740274 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 4-[6-ethyl-5-methyl-4-(methylamino)thieno[2,3-d]pyrimidin-2-yl]piperazine-1-carbaldehyde |
| SMILES | CCc1sc2nc(N3CCN(C=O)CC3)nc(NC)c2c1C |
| InChI | InChI=1S/C15H21N5OS/c1-4-11-10(2)12-13(16-3)17-15(18-14(12)22-11)20-7-5-19(9-21)6-8-20/h9H,4-8H2,1-3H3,(H,16,17,18) |
| InChIKey | NRVZQNZDKRIZJB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|