C17H22N6O2S — CID 143626952
6-ethyl-4-(furan-3-yl)-2-piperazin-1-ylthieno[2,3-d]pyrimidin-5-amine;formamide (PubChem CID 143626952) has the molecular formula C17H22N6O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is 6-ethyl-4-(furan-3-yl)-2-piperazin-1-ylthieno[2,3-d]pyrimidin-5-amine;formamide.
| Compound Name | 6-ethyl-4-(furan-3-yl)-2-piperazin-1-ylthieno[2,3-d]pyrimidin-5-amine;formamide |
|---|---|
| PubChem CID | 143626952 |
| Molecular Formula | C17H22N6O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 6-ethyl-4-(furan-3-yl)-2-piperazin-1-ylthieno[2,3-d]pyrimidin-5-amine;formamide |
| SMILES | CCc1sc2nc(N3CCNCC3)nc(-c3ccoc3)c2c1N.NC=O |
| InChI | InChI=1S/C16H19N5OS.CH3NO/c1-2-11-13(17)12-14(10-3-8-22-9-10)19-16(20-15(12)23-11)21-6-4-18-5-7-21;2-1-3/h3,8-9,18H,2,4-7,17H2,1H3;1H,(H2,2,3) |
| InChIKey | NJGKYITVGPHHCH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|