C17H18N4S — CID 3062911
5-methyl-4-phenyl-2-piperazin-1-ylthieno[2,3-d]pyrimidine (PubChem CID 3062911) has the molecular formula C17H18N4S and a molecular weight of 310.43 g/mol. Its IUPAC name is 5-methyl-4-phenyl-2-piperazin-1-ylthieno[2,3-d]pyrimidine.
| Compound Name | 5-methyl-4-phenyl-2-piperazin-1-ylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 3062911 |
| Molecular Formula | C17H18N4S |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 5-methyl-4-phenyl-2-piperazin-1-ylthieno[2,3-d]pyrimidine |
| SMILES | Cc1csc2nc(N3CCNCC3)nc(-c3ccccc3)c12 |
| InChI | InChI=1S/C17H18N4S/c1-12-11-22-16-14(12)15(13-5-3-2-4-6-13)19-17(20-16)21-9-7-18-8-10-21/h2-6,11,18H,7-10H2,1H3 |
| InChIKey | PRCNRXJOWBHJHI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |