C20H22N4O2S — CID 147071236
2-[2-amino-5-(furan-3-yl)phenyl]-1-(4-methyl-5-piperazin-1-yl-1,3-thiazol-2-yl)ethanone (PubChem CID 147071236) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 2-[2-amino-5-(furan-3-yl)phenyl]-1-(4-methyl-5-piperazin-1-yl-1,3-thiazol-2-yl)ethanone.
| Compound Name | 2-[2-amino-5-(furan-3-yl)phenyl]-1-(4-methyl-5-piperazin-1-yl-1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 147071236 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-[2-amino-5-(furan-3-yl)phenyl]-1-(4-methyl-5-piperazin-1-yl-1,3-thiazol-2-yl)ethanone |
| SMILES | Cc1nc(C(=O)Cc2cc(-c3ccoc3)ccc2N)sc1N1CCNCC1 |
| InChI | InChI=1S/C20H22N4O2S/c1-13-20(24-7-5-22-6-8-24)27-19(23-13)18(25)11-16-10-14(2-3-17(16)21)15-4-9-26-12-15/h2-4,9-10,12,22H,5-8,11,21H2,1H3 |
| InChIKey | BFCBGCFXPURPKT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|