C22H25N3O3 — CID 174575991
N-[2-amino-5-(furan-3-yl)phenyl]-4-methylbenzamide;morpholine (PubChem CID 174575991) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[2-amino-5-(furan-3-yl)phenyl]-4-methylbenzamide;morpholine.
| Compound Name | N-[2-amino-5-(furan-3-yl)phenyl]-4-methylbenzamide;morpholine |
|---|---|
| PubChem CID | 174575991 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[2-amino-5-(furan-3-yl)phenyl]-4-methylbenzamide;morpholine |
| SMILES | C1COCCN1.Cc1ccc(C(=O)Nc2cc(-c3ccoc3)ccc2N)cc1 |
| InChI | InChI=1S/C18H16N2O2.C4H9NO/c1-12-2-4-13(5-3-12)18(21)20-17-10-14(6-7-16(17)19)15-8-9-22-11-15;1-3-6-4-2-5-1/h2-11H,19H2,1H3,(H,20,21);5H,1-4H2 |
| InChIKey | HPEIMZTVHYYFIH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|